C11H11ClO3S2 — CID 10589628
(2R,4R,8R)-2-(4-chlorophenyl)-1-oxa-4lambda4,8lambda4-dithiaspiro[2.5]octane 4,8-dioxide (PubChem CID 10589628) has the molecular formula C11H11ClO3S2 and a molecular weight of 290.79 g/mol. Its IUPAC name is (2R,4R,8R)-2-(4-chlorophenyl)-1-oxa-4lambda4,8lambda4-dithiaspiro[2.5]octane 4,8-dioxide.
| Compound Name | (2R,4R,8R)-2-(4-chlorophenyl)-1-oxa-4lambda4,8lambda4-dithiaspiro[2.5]octane 4,8-dioxide |
|---|---|
| PubChem CID | 10589628 |
| Molecular Formula | C11H11ClO3S2 |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | (2R,4R,8R)-2-(4-chlorophenyl)-1-oxa-4lambda4,8lambda4-dithiaspiro[2.5]octane 4,8-dioxide |
| SMILES | O=[S@@]1CCC[S@@](=O)C12O[C@@H]2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H11ClO3S2/c12-9-4-2-8(3-5-9)10-11(15-10)16(13)6-1-7-17(11)14/h2-5,10H,1,6-7H2/t10-,16-,17-/m1/s1 |
| InChIKey | AYMYHWXOBJAXMW-FDOKIQAASA-N |
| XLogP | 1.97 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|