C11H9ClO3 — CID 11499565
4-(4-chlorophenyl)-6-methylidene-1,3-dioxan-2-one (PubChem CID 11499565) has the molecular formula C11H9ClO3 and a molecular weight of 224.64 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-6-methylidene-1,3-dioxan-2-one.
| Compound Name | 4-(4-chlorophenyl)-6-methylidene-1,3-dioxan-2-one |
|---|---|
| PubChem CID | 11499565 |
| Molecular Formula | C11H9ClO3 |
| Molecular Weight | 224.64 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 4-(4-chlorophenyl)-6-methylidene-1,3-dioxan-2-one |
| SMILES | C=C1CC(c2ccc(Cl)cc2)OC(=O)O1 |
| InChI | InChI=1S/C11H9ClO3/c1-7-6-10(15-11(13)14-7)8-2-4-9(12)5-3-8/h2-5,10H,1,6H2 |
| InChIKey | NEPSHFGOKJNEKC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.64 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |