C18H17ClO — CID 24774784
(2R,6S)-2-(4-chlorophenyl)-4-methylidene-6-phenyloxane (PubChem CID 24774784) has the molecular formula C18H17ClO and a molecular weight of 284.79 g/mol. Its IUPAC name is (2R,6S)-2-(4-chlorophenyl)-4-methylidene-6-phenyloxane.
| Compound Name | (2R,6S)-2-(4-chlorophenyl)-4-methylidene-6-phenyloxane |
|---|---|
| PubChem CID | 24774784 |
| Molecular Formula | C18H17ClO |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | (2R,6S)-2-(4-chlorophenyl)-4-methylidene-6-phenyloxane |
| SMILES | C=C1C[C@@H](c2ccccc2)O[C@@H](c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C18H17ClO/c1-13-11-17(14-5-3-2-4-6-14)20-18(12-13)15-7-9-16(19)10-8-15/h2-10,17-18H,1,11-12H2/t17-,18+/m0/s1 |
| InChIKey | RALGYQVQTJOSES-ZWKOTPCHSA-N |
| XLogP | 5.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|