C10H9Br2ClO — CID 23253730
(2S,3S,5R)-2,3-dibromo-5-(4-chlorophenyl)oxolane (PubChem CID 23253730) has the molecular formula C10H9Br2ClO and a molecular weight of 340.44 g/mol. Its IUPAC name is (2S,3S,5R)-2,3-dibromo-5-(4-chlorophenyl)oxolane.
| Compound Name | (2S,3S,5R)-2,3-dibromo-5-(4-chlorophenyl)oxolane |
|---|---|
| PubChem CID | 23253730 |
| Molecular Formula | C10H9Br2ClO |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 337.87 |
| IUPAC Name | (2S,3S,5R)-2,3-dibromo-5-(4-chlorophenyl)oxolane |
| SMILES | Clc1ccc([C@H]2C[C@H](Br)[C@H](Br)O2)cc1 |
| InChI | InChI=1S/C10H9Br2ClO/c11-8-5-9(14-10(8)12)6-1-3-7(13)4-2-6/h1-4,8-10H,5H2/t8-,9+,10+/m0/s1 |
| InChIKey | BJAYYQQDXKZPSD-IVZWLZJFSA-N |
| XLogP | 4.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|