C15H13ClO2 — CID 10706498
(1R,3R)-3-(4-chlorophenyl)-3,4-dihydro-1H-isochromen-1-ol (PubChem CID 10706498) has the molecular formula C15H13ClO2 and a molecular weight of 260.72 g/mol. Its IUPAC name is (1R,3R)-3-(4-chlorophenyl)-3,4-dihydro-1H-isochromen-1-ol.
| Compound Name | (1R,3R)-3-(4-chlorophenyl)-3,4-dihydro-1H-isochromen-1-ol |
|---|---|
| PubChem CID | 10706498 |
| Molecular Formula | C15H13ClO2 |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | (1R,3R)-3-(4-chlorophenyl)-3,4-dihydro-1H-isochromen-1-ol |
| SMILES | O[C@@H]1O[C@@H](c2ccc(Cl)cc2)Cc2ccccc21 |
| InChI | InChI=1S/C15H13ClO2/c16-12-7-5-10(6-8-12)14-9-11-3-1-2-4-13(11)15(17)18-14/h1-8,14-15,17H,9H2/t14-,15-/m1/s1 |
| InChIKey | VYVSWIXUILGPAY-HUUCEWRRSA-N |
| XLogP | 3.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |