About 2-phenyl-1,3-dithiepane 1-oxide
2-phenyl-1,3-dithiepane 1-oxide (PubChem CID 102414340) has the molecular formula C11H14OS2
and a molecular weight of 226.37 g/mol. Its IUPAC name is 2-phenyl-1,3-dithiepane 1-oxide.
Molecular Properties
| Compound Name | 2-phenyl-1,3-dithiepane 1-oxide |
| PubChem CID | 102414340 |
| Molecular Formula | C11H14OS2 |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 2-phenyl-1,3-dithiepane 1-oxide |
| SMILES | O=S1CCCCSC1c1ccccc1 |
| InChI | InChI=1S/C11H14OS2/c12-14-9-5-4-8-13-11(14)10-6-2-1-3-7-10/h1-3,6-7,11H,4-5,8-9H2 |
| InChIKey | DDBTYCQIKMSBKG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenyl-1,3-dithiepane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-1,3-dithiepane 1-oxide?
The IUPAC name of 2-phenyl-1,3-dithiepane 1-oxide (CID 102414340) is 2-phenyl-1,3-dithiepane 1-oxide.
What is the SMILES notation for 2-phenyl-1,3-dithiepane 1-oxide?
The canonical SMILES for 2-phenyl-1,3-dithiepane 1-oxide is O=S1CCCCSC1c1ccccc1.
What is the InChIKey of 2-phenyl-1,3-dithiepane 1-oxide?
The InChIKey is DDBTYCQIKMSBKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14OS2/c12-14-9-5-4-8-13-11(14)10-6-2-1-3-7-10/h1-3,6-7,11H,4-5,8-9H2.
What are the key properties of 2-phenyl-1,3-dithiepane 1-oxide?
2-phenyl-1,3-dithiepane 1-oxide has a molecular weight of 226.37 g/mol, XLogP of 2.96, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-1,3-dithiepane 1-oxide is sourced from PubChem (CID 102414340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).