C11H14OS2 — CID 102414340
2-phenyl-1,3-dithiepane 1-oxide (PubChem CID 102414340) has the molecular formula C11H14OS2 and a molecular weight of 226.37 g/mol. Its IUPAC name is 2-phenyl-1,3-dithiepane 1-oxide.
| Compound Name | 2-phenyl-1,3-dithiepane 1-oxide |
|---|---|
| PubChem CID | 102414340 |
| Molecular Formula | C11H14OS2 |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 2-phenyl-1,3-dithiepane 1-oxide |
| SMILES | O=S1CCCCSC1c1ccccc1 |
| InChI | InChI=1S/C11H14OS2/c12-14-9-5-4-8-13-11(14)10-6-2-1-3-7-10/h1-3,6-7,11H,4-5,8-9H2 |
| InChIKey | DDBTYCQIKMSBKG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |