About 2-methyl-3-phenyl-1,4-thiazepane 1-oxide
2-methyl-3-phenyl-1,4-thiazepane 1-oxide (PubChem CID 66217785) has the molecular formula C12H17NOS
and a molecular weight of 223.34 g/mol. Its IUPAC name is 2-methyl-3-phenyl-1,4-thiazepane 1-oxide.
Molecular Properties
| Compound Name | 2-methyl-3-phenyl-1,4-thiazepane 1-oxide |
| PubChem CID | 66217785 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-methyl-3-phenyl-1,4-thiazepane 1-oxide |
| SMILES | CC1C(c2ccccc2)NCCCS1=O |
| InChI | InChI=1S/C12H17NOS/c1-10-12(11-6-3-2-4-7-11)13-8-5-9-15(10)14/h2-4,6-7,10,12-13H,5,8-9H2,1H3 |
| InChIKey | UALKBCOPHKOGHL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-3-phenyl-1,4-thiazepane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-phenyl-1,4-thiazepane 1-oxide?
The IUPAC name of 2-methyl-3-phenyl-1,4-thiazepane 1-oxide (CID 66217785) is 2-methyl-3-phenyl-1,4-thiazepane 1-oxide.
What is the SMILES notation for 2-methyl-3-phenyl-1,4-thiazepane 1-oxide?
The canonical SMILES for 2-methyl-3-phenyl-1,4-thiazepane 1-oxide is CC1C(c2ccccc2)NCCCS1=O.
What is the InChIKey of 2-methyl-3-phenyl-1,4-thiazepane 1-oxide?
The InChIKey is UALKBCOPHKOGHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NOS/c1-10-12(11-6-3-2-4-7-11)13-8-5-9-15(10)14/h2-4,6-7,10,12-13H,5,8-9H2,1H3.
What are the key properties of 2-methyl-3-phenyl-1,4-thiazepane 1-oxide?
2-methyl-3-phenyl-1,4-thiazepane 1-oxide has a molecular weight of 223.34 g/mol, XLogP of 1.86, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-phenyl-1,4-thiazepane 1-oxide is sourced from PubChem (CID 66217785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).