C12H17NOS — CID 66217785
2-methyl-3-phenyl-1,4-thiazepane 1-oxide (PubChem CID 66217785) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is 2-methyl-3-phenyl-1,4-thiazepane 1-oxide.
| Compound Name | 2-methyl-3-phenyl-1,4-thiazepane 1-oxide |
|---|---|
| PubChem CID | 66217785 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-methyl-3-phenyl-1,4-thiazepane 1-oxide |
| SMILES | CC1C(c2ccccc2)NCCCS1=O |
| InChI | InChI=1S/C12H17NOS/c1-10-12(11-6-3-2-4-7-11)13-8-5-9-15(10)14/h2-4,6-7,10,12-13H,5,8-9H2,1H3 |
| InChIKey | UALKBCOPHKOGHL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |