C9H9NO2S — CID 87836688
1-oxo-2-phenyl-1,3-thiazolidin-4-one (PubChem CID 87836688) has the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. Its IUPAC name is 1-oxo-2-phenyl-1,3-thiazolidin-4-one.
| Compound Name | 1-oxo-2-phenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 87836688 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 1-oxo-2-phenyl-1,3-thiazolidin-4-one |
| SMILES | O=C1CS(=O)C(c2ccccc2)N1 |
| InChI | InChI=1S/C9H9NO2S/c11-8-6-13(12)9(10-8)7-4-2-1-3-5-7/h1-5,9H,6H2,(H,10,11) |
| InChIKey | CMKZKCOXQUNFPX-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |