C26H30N2O2 — CID 75307773
6,13-dimethyl-7,14-diphenyl-1,8-diazacyclotetradeca-4,11-diene-2,9-dione (PubChem CID 75307773) has the molecular formula C26H30N2O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 6,13-dimethyl-7,14-diphenyl-1,8-diazacyclotetradeca-4,11-diene-2,9-dione.
| Compound Name | 6,13-dimethyl-7,14-diphenyl-1,8-diazacyclotetradeca-4,11-diene-2,9-dione |
|---|---|
| PubChem CID | 75307773 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 6,13-dimethyl-7,14-diphenyl-1,8-diazacyclotetradeca-4,11-diene-2,9-dione |
| SMILES | CC1C=CCC(=O)NC(c2ccccc2)C(C)C=CCC(=O)NC1c1ccccc1 |
| InChI | InChI=1S/C26H30N2O2/c1-19-11-9-17-24(30)28-26(22-15-7-4-8-16-22)20(2)12-10-18-23(29)27-25(19)21-13-5-3-6-14-21/h3-16,19-20,25-26H,17-18H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | NRHNQHSEKZNYCZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|