C33H33ClN4O3 — CID 155537771
(3S,7S,11E,13S,14R)-7-(4-chlorophenyl)-3-(1H-indol-3-ylmethyl)-13-methyl-14-phenyl-1,4,8-triazacyclotetradec-11-ene-2,5,9-trione (PubChem CID 155537771) has the molecular formula C33H33ClN4O3 and a molecular weight of 569.11 g/mol. Its IUPAC name is (3S,7S,11E,13S,14R)-7-(4-chlorophenyl)-3-(1H-indol-3-ylmethyl)-13-methyl-14-phenyl-1,4,8-triazacyclotetradec-11-ene-2,5,9-trione.
| Compound Name | (3S,7S,11E,13S,14R)-7-(4-chlorophenyl)-3-(1H-indol-3-ylmethyl)-13-methyl-14-phenyl-1,4,8-triazacyclotetradec-11-ene-2,5,9-trione |
|---|---|
| PubChem CID | 155537771 |
| Molecular Formula | C33H33ClN4O3 |
| Molecular Weight | 569.11 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | (3S,7S,11E,13S,14R)-7-(4-chlorophenyl)-3-(1H-indol-3-ylmethyl)-13-methyl-14-phenyl-1,4,8-triazacyclotetradec-11-ene-2,5,9-trione |
| SMILES | C[C@H]1/C=C/CC(=O)N[C@H](c2ccc(Cl)cc2)CC(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C33H33ClN4O3/c1-21-8-7-13-30(39)36-28(22-14-16-25(34)17-15-22)19-31(40)37-29(18-24-20-35-27-12-6-5-11-26(24)27)33(41)38-32(21)23-9-3-2-4-10-23/h2-12,14-17,20-21,28-29,32,35H,13,18-19H2,1H3,(H,36,39)(H,37,40)(H,38,41)/b8-7+/t21-,28-,29-,32+/m0/s1 |
| InChIKey | RPPKOWVZDYCIDY-ATZCZCKNSA-N |
| XLogP | 5.55 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.11 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|