C8H13NO — CID 123935100
2,3-dimethyl-1,2,3,6-tetrahydroazepin-7-one (PubChem CID 123935100) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is 2,3-dimethyl-1,2,3,6-tetrahydroazepin-7-one.
| Compound Name | 2,3-dimethyl-1,2,3,6-tetrahydroazepin-7-one |
|---|---|
| PubChem CID | 123935100 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 2,3-dimethyl-1,2,3,6-tetrahydroazepin-7-one |
| SMILES | CC1C=CCC(=O)NC1C |
| InChI | InChI=1S/C8H13NO/c1-6-4-3-5-8(10)9-7(6)2/h3-4,6-7H,5H2,1-2H3,(H,9,10) |
| InChIKey | ONGMCCUOHSGJSI-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|