C15H23N — CID 131847537
(2S,4R)-2-tert-butyl-1-methyl-4-phenylpyrrolidine (PubChem CID 131847537) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is (2S,4R)-2-tert-butyl-1-methyl-4-phenylpyrrolidine.
| Compound Name | (2S,4R)-2-tert-butyl-1-methyl-4-phenylpyrrolidine |
|---|---|
| PubChem CID | 131847537 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | (2S,4R)-2-tert-butyl-1-methyl-4-phenylpyrrolidine |
| SMILES | CN1C[C@@H](c2ccccc2)C[C@H]1C(C)(C)C |
| InChI | InChI=1S/C15H23N/c1-15(2,3)14-10-13(11-16(14)4)12-8-6-5-7-9-12/h5-9,13-14H,10-11H2,1-4H3/t13-,14-/m0/s1 |
| InChIKey | YTUQCVVVEXPZLY-KBPBESRZSA-N |
| XLogP | 3.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |