C16H17NO — CID 101268186
[(2S)-1-methylaziridin-2-yl]-diphenylmethanol (PubChem CID 101268186) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is [(2S)-1-methylaziridin-2-yl]-diphenylmethanol.
| Compound Name | [(2S)-1-methylaziridin-2-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 101268186 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | [(2S)-1-methylaziridin-2-yl]-diphenylmethanol |
| SMILES | CN1C[C@H]1C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H17NO/c1-17-12-15(17)16(18,13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11,15,18H,12H2,1H3/t15-,17?/m0/s1 |
| InChIKey | AJOMLSCKRPIGFH-MYJWUSKBSA-N |
| XLogP | 2.24 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|