C17H19NO4S — CID 71426341
(2R)-2-[hydroxy(diphenyl)methyl]pyrrolidine-1-sulfonic acid (PubChem CID 71426341) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is (2R)-2-[hydroxy(diphenyl)methyl]pyrrolidine-1-sulfonic acid.
| Compound Name | (2R)-2-[hydroxy(diphenyl)methyl]pyrrolidine-1-sulfonic acid |
|---|---|
| PubChem CID | 71426341 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | (2R)-2-[hydroxy(diphenyl)methyl]pyrrolidine-1-sulfonic acid |
| SMILES | O=S(=O)(O)N1CCC[C@@H]1C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H19NO4S/c19-17(14-8-3-1-4-9-14,15-10-5-2-6-11-15)16-12-7-13-18(16)23(20,21)22/h1-6,8-11,16,19H,7,12-13H2,(H,20,21,22)/t16-/m1/s1 |
| InChIKey | PTMUNQVTYYQRGB-MRXNPFEDSA-N |
| XLogP | 2.19 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|