C23H21Cl2NO3S — CID 100992317
[(2S)-1-(2,5-dichlorophenyl)sulfonylpyrrolidin-2-yl]-diphenylmethanol (PubChem CID 100992317) has the molecular formula C23H21Cl2NO3S and a molecular weight of 462.40 g/mol. Its IUPAC name is [(2S)-1-(2,5-dichlorophenyl)sulfonylpyrrolidin-2-yl]-diphenylmethanol.
| Compound Name | [(2S)-1-(2,5-dichlorophenyl)sulfonylpyrrolidin-2-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 100992317 |
| Molecular Formula | C23H21Cl2NO3S |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | [(2S)-1-(2,5-dichlorophenyl)sulfonylpyrrolidin-2-yl]-diphenylmethanol |
| SMILES | O=S(=O)(c1cc(Cl)ccc1Cl)N1CCC[C@H]1C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H21Cl2NO3S/c24-19-13-14-20(25)21(16-19)30(28,29)26-15-7-12-22(26)23(27,17-8-3-1-4-9-17)18-10-5-2-6-11-18/h1-6,8-11,13-14,16,22,27H,7,12,15H2/t22-/m0/s1 |
| InChIKey | FWGSVNMCOGSPSY-QFIPXVFZSA-N |
| XLogP | 5.08 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |