C23H20Cl2N2O3S — CID 42702705
1-(2,5-dichlorophenyl)sulfonyl-N-(2-phenylphenyl)pyrrolidine-2-carboxamide (PubChem CID 42702705) has the molecular formula C23H20Cl2N2O3S and a molecular weight of 475.40 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)sulfonyl-N-(2-phenylphenyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(2,5-dichlorophenyl)sulfonyl-N-(2-phenylphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 42702705 |
| Molecular Formula | C23H20Cl2N2O3S |
| Molecular Weight | 475.40 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | 1-(2,5-dichlorophenyl)sulfonyl-N-(2-phenylphenyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1-c1ccccc1)C1CCCN1S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C23H20Cl2N2O3S/c24-17-12-13-19(25)22(15-17)31(29,30)27-14-6-11-21(27)23(28)26-20-10-5-4-9-18(20)16-7-2-1-3-8-16/h1-5,7-10,12-13,15,21H,6,11,14H2,(H,26,28) |
| InChIKey | YOSWJKZEMADOQI-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.40 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |