C19H24NO4P — CID 10642322
[(2S)-1-dimethoxyphosphorylpyrrolidin-2-yl]-diphenylmethanol (PubChem CID 10642322) has the molecular formula C19H24NO4P and a molecular weight of 361.38 g/mol. Its IUPAC name is [(2S)-1-dimethoxyphosphorylpyrrolidin-2-yl]-diphenylmethanol.
| Compound Name | [(2S)-1-dimethoxyphosphorylpyrrolidin-2-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 10642322 |
| Molecular Formula | C19H24NO4P |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | [(2S)-1-dimethoxyphosphorylpyrrolidin-2-yl]-diphenylmethanol |
| SMILES | COP(=O)(OC)N1CCC[C@H]1C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H24NO4P/c1-23-25(22,24-2)20-15-9-14-18(20)19(21,16-10-5-3-6-11-16)17-12-7-4-8-13-17/h3-8,10-13,18,21H,9,14-15H2,1-2H3/t18-/m0/s1 |
| InChIKey | ATULOANARFGKDE-SFHVURJKSA-N |
| XLogP | 3.79 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|