C15H22NO5P — CID 10592285
benzyl (2S)-2-(dimethoxyphosphorylmethyl)pyrrolidine-1-carboxylate (PubChem CID 10592285) has the molecular formula C15H22NO5P and a molecular weight of 327.32 g/mol. Its IUPAC name is benzyl (2S)-2-(dimethoxyphosphorylmethyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-(dimethoxyphosphorylmethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10592285 |
| Molecular Formula | C15H22NO5P |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | benzyl (2S)-2-(dimethoxyphosphorylmethyl)pyrrolidine-1-carboxylate |
| SMILES | COP(=O)(C[C@@H]1CCCN1C(=O)OCc1ccccc1)OC |
| InChI | InChI=1S/C15H22NO5P/c1-19-22(18,20-2)12-14-9-6-10-16(14)15(17)21-11-13-7-4-3-5-8-13/h3-5,7-8,14H,6,9-12H2,1-2H3/t14-/m0/s1 |
| InChIKey | PGHSMIRFJHXWAV-AWEZNQCLSA-N |
| XLogP | 3.27 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|