C15H20NO6P — CID 165341202
benzyl (2S)-2-dimethoxyphosphorylcarbonylpyrrolidine-1-carboxylate (PubChem CID 165341202) has the molecular formula C15H20NO6P and a molecular weight of 341.30 g/mol. Its IUPAC name is benzyl (2S)-2-dimethoxyphosphorylcarbonylpyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-dimethoxyphosphorylcarbonylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 165341202 |
| Molecular Formula | C15H20NO6P |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | benzyl (2S)-2-dimethoxyphosphorylcarbonylpyrrolidine-1-carboxylate |
| SMILES | COP(=O)(OC)C(=O)[C@@H]1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H20NO6P/c1-20-23(19,21-2)14(17)13-9-6-10-16(13)15(18)22-11-12-7-4-3-5-8-12/h3-5,7-8,13H,6,9-11H2,1-2H3/t13-/m0/s1 |
| InChIKey | ZGTCACYJLNOXAG-ZDUSSCGKSA-N |
| XLogP | 2.80 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|