C15H21N3O3 — CID 59006552
benzyl (2R)-2-[(methylcarbamoylamino)methyl]pyrrolidine-1-carboxylate (PubChem CID 59006552) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is benzyl (2R)-2-[(methylcarbamoylamino)methyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R)-2-[(methylcarbamoylamino)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59006552 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | benzyl (2R)-2-[(methylcarbamoylamino)methyl]pyrrolidine-1-carboxylate |
| SMILES | CNC(=O)NC[C@H]1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H21N3O3/c1-16-14(19)17-10-13-8-5-9-18(13)15(20)21-11-12-6-3-2-4-7-12/h2-4,6-7,13H,5,8-11H2,1H3,(H2,16,17,19)/t13-/m1/s1 |
| InChIKey | BVFGTIQUJQKAIA-CYBMUJFWSA-N |
| XLogP | 1.72 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |