C26H28N2O3 — CID 102304812
3-[(2S)-2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]-4-piperidin-1-ylcyclobut-3-ene-1,2-dione (PubChem CID 102304812) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is 3-[(2S)-2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]-4-piperidin-1-ylcyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(2S)-2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]-4-piperidin-1-ylcyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 102304812 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 3-[(2S)-2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]-4-piperidin-1-ylcyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(N2CCCCC2)c(N2CCC[C@H]2C(O)(c2ccccc2)c2ccccc2)c1=O |
| InChI | InChI=1S/C26H28N2O3/c29-24-22(27-16-8-3-9-17-27)23(25(24)30)28-18-10-15-21(28)26(31,19-11-4-1-5-12-19)20-13-6-2-7-14-20/h1-2,4-7,11-14,21,31H,3,8-10,15-18H2/t21-/m0/s1 |
| InChIKey | QVCQJILRVAZRJA-NRFANRHFSA-N |
| XLogP | 3.18 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|