C16H15NO3 — CID 11832441
3-benzoyl-4-piperidin-1-ylcyclobut-3-ene-1,2-dione (PubChem CID 11832441) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 3-benzoyl-4-piperidin-1-ylcyclobut-3-ene-1,2-dione.
| Compound Name | 3-benzoyl-4-piperidin-1-ylcyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 11832441 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 3-benzoyl-4-piperidin-1-ylcyclobut-3-ene-1,2-dione |
| SMILES | O=C(c1ccccc1)c1c(N2CCCCC2)c(=O)c1=O |
| InChI | InChI=1S/C16H15NO3/c18-14(11-7-3-1-4-8-11)12-13(16(20)15(12)19)17-9-5-2-6-10-17/h1,3-4,7-8H,2,5-6,9-10H2 |
| InChIKey | HHZQKBNMMWFFBP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|