C40H41NO5 — CID 16754944
bis[4-(dimethoxymethyl)phenyl]-[(2S)-1-tritylaziridin-2-yl]methanol (PubChem CID 16754944) has the molecular formula C40H41NO5 and a molecular weight of 615.77 g/mol. Its IUPAC name is bis[4-(dimethoxymethyl)phenyl]-[(2S)-1-tritylaziridin-2-yl]methanol.
| Compound Name | bis[4-(dimethoxymethyl)phenyl]-[(2S)-1-tritylaziridin-2-yl]methanol |
|---|---|
| PubChem CID | 16754944 |
| Molecular Formula | C40H41NO5 |
| Molecular Weight | 615.77 g/mol |
| Exact Mass | 615.30 |
| IUPAC Name | bis[4-(dimethoxymethyl)phenyl]-[(2S)-1-tritylaziridin-2-yl]methanol |
| SMILES | COC(OC)c1ccc(C(O)(c2ccc(C(OC)OC)cc2)[C@@H]2CN2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C40H41NO5/c1-43-37(44-2)29-20-24-34(25-21-29)40(42,35-26-22-30(23-27-35)38(45-3)46-4)36-28-41(36)39(31-14-8-5-9-15-31,32-16-10-6-11-17-32)33-18-12-7-13-19-33/h5-27,36-38,42H,28H2,1-4H3/t36-,41?/m0/s1 |
| InChIKey | LHDIFTANLZEKGM-ZKDJKKMOSA-N |
| XLogP | 7.18 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.77 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|