C31H31NO2 — CID 177412112
(4-methoxyphenyl)-[(2S)-1-tritylpyrrolidin-2-yl]methanol (PubChem CID 177412112) has the molecular formula C31H31NO2 and a molecular weight of 449.59 g/mol. Its IUPAC name is (4-methoxyphenyl)-[(2S)-1-tritylpyrrolidin-2-yl]methanol.
| Compound Name | (4-methoxyphenyl)-[(2S)-1-tritylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 177412112 |
| Molecular Formula | C31H31NO2 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | (4-methoxyphenyl)-[(2S)-1-tritylpyrrolidin-2-yl]methanol |
| SMILES | COc1ccc(C(O)[C@@H]2CCCN2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H31NO2/c1-34-28-21-19-24(20-22-28)30(33)29-18-11-23-32(29)31(25-12-5-2-6-13-25,26-14-7-3-8-15-26)27-16-9-4-10-17-27/h2-10,12-17,19-22,29-30,33H,11,18,23H2,1H3/t29-,30?/m0/s1 |
| InChIKey | PZSIQTVDXWFRBT-UFXYQILXSA-N |
| XLogP | 6.19 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|