C37H36NO2P — CID 165163748
2-diphenylphosphoryl-1-[(2S)-1-tritylpyrrolidin-2-yl]ethanol (PubChem CID 165163748) has the molecular formula C37H36NO2P and a molecular weight of 557.67 g/mol. Its IUPAC name is 2-diphenylphosphoryl-1-[(2S)-1-tritylpyrrolidin-2-yl]ethanol.
| Compound Name | 2-diphenylphosphoryl-1-[(2S)-1-tritylpyrrolidin-2-yl]ethanol |
|---|---|
| PubChem CID | 165163748 |
| Molecular Formula | C37H36NO2P |
| Molecular Weight | 557.67 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | 2-diphenylphosphoryl-1-[(2S)-1-tritylpyrrolidin-2-yl]ethanol |
| SMILES | O=P(CC(O)[C@@H]1CCCN1C(c1ccccc1)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H36NO2P/c39-36(29-41(40,33-23-12-4-13-24-33)34-25-14-5-15-26-34)35-27-16-28-38(35)37(30-17-6-1-7-18-30,31-19-8-2-9-20-31)32-21-10-3-11-22-32/h1-15,17-26,35-36,39H,16,27-29H2/t35-,36?/m0/s1 |
| InChIKey | NVGDCFNHATWKDE-TYIYNAFKSA-N |
| XLogP | 6.82 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.67 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|