C53H57N3O5 — CID 167620756
(1R)-2-nitro-1-[(2S)-1-tritylpyrrolidin-2-yl]ethanol;oxolane;(2S)-1-tritylpyrrolidine-2-carbaldehyde (PubChem CID 167620756) has the molecular formula C53H57N3O5 and a molecular weight of 816.06 g/mol. Its IUPAC name is (1R)-2-nitro-1-[(2S)-1-tritylpyrrolidin-2-yl]ethanol;oxolane;(2S)-1-tritylpyrrolidine-2-carbaldehyde.
| Compound Name | (1R)-2-nitro-1-[(2S)-1-tritylpyrrolidin-2-yl]ethanol;oxolane;(2S)-1-tritylpyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 167620756 |
| Molecular Formula | C53H57N3O5 |
| Molecular Weight | 816.06 g/mol |
| Exact Mass | 815.43 |
| IUPAC Name | (1R)-2-nitro-1-[(2S)-1-tritylpyrrolidin-2-yl]ethanol;oxolane;(2S)-1-tritylpyrrolidine-2-carbaldehyde |
| SMILES | C1CCOC1.O=C[C@@H]1CCCN1C(c1ccccc1)(c1ccccc1)c1ccccc1.O=[N+]([O-])C[C@@H](O)[C@@H]1CCCN1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26N2O3.C24H23NO.C4H8O/c28-24(19-27(29)30)23-17-10-18-26(23)25(20-11-4-1-5-12-20,21-13-6-2-7-14-21)22-15-8-3-9-16-22;26-19-23-17-10-18-25(23)24(20-11-4-1-5-12-20,21-13-6-2-7-14-21)22-15-8-3-9-16-22;1-2-4-5-3-1/h1-9,11-16,23-24,28H,10,17-19H2;1-9,11-16,19,23H,10,17-18H2;1-4H2/t23-,24+;23-;/m00./s1 |
| InChIKey | MKDOMYVBYPVRGO-AETTYXBNSA-N |
| XLogP | 9.52 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.06 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|