C29H27NO3S — CID 141308119
(R)-(4-methylsulfonylphenyl)-(1-tritylaziridin-2-yl)methanol (PubChem CID 141308119) has the molecular formula C29H27NO3S and a molecular weight of 469.61 g/mol. Its IUPAC name is (R)-(4-methylsulfonylphenyl)-(1-tritylaziridin-2-yl)methanol.
| Compound Name | (R)-(4-methylsulfonylphenyl)-(1-tritylaziridin-2-yl)methanol |
|---|---|
| PubChem CID | 141308119 |
| Molecular Formula | C29H27NO3S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | (R)-(4-methylsulfonylphenyl)-(1-tritylaziridin-2-yl)methanol |
| SMILES | CS(=O)(=O)c1ccc([C@@H](O)C2CN2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H27NO3S/c1-34(32,33)26-19-17-22(18-20-26)28(31)27-21-30(27)29(23-11-5-2-6-12-23,24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-20,27-28,31H,21H2,1H3/t27?,28-,30?/m1/s1 |
| InChIKey | ADNJQKGTNJBUNT-JJMYMTGCSA-N |
| XLogP | 4.80 |
| TPSA | 57.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|