C19H23NO3S — CID 125145320
(1S)-1-(4-methylsulfonylphenyl)-2-[(2S)-2-phenylpyrrolidin-1-yl]ethanol (PubChem CID 125145320) has the molecular formula C19H23NO3S and a molecular weight of 345.46 g/mol. Its IUPAC name is (1S)-1-(4-methylsulfonylphenyl)-2-[(2S)-2-phenylpyrrolidin-1-yl]ethanol.
| Compound Name | (1S)-1-(4-methylsulfonylphenyl)-2-[(2S)-2-phenylpyrrolidin-1-yl]ethanol |
|---|---|
| PubChem CID | 125145320 |
| Molecular Formula | C19H23NO3S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | (1S)-1-(4-methylsulfonylphenyl)-2-[(2S)-2-phenylpyrrolidin-1-yl]ethanol |
| SMILES | CS(=O)(=O)c1ccc([C@H](O)CN2CCC[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C19H23NO3S/c1-24(22,23)17-11-9-16(10-12-17)19(21)14-20-13-5-8-18(20)15-6-3-2-4-7-15/h2-4,6-7,9-12,18-19,21H,5,8,13-14H2,1H3/t18-,19+/m0/s1 |
| InChIKey | RVQWRHSMKTUIAP-RBUKOAKNSA-N |
| XLogP | 2.96 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |