C17H25NO3S — CID 111488287
2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-1-(4-methylsulfonylphenyl)ethanol (PubChem CID 111488287) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is 2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-1-(4-methylsulfonylphenyl)ethanol.
| Compound Name | 2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-1-(4-methylsulfonylphenyl)ethanol |
|---|---|
| PubChem CID | 111488287 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-1-(4-methylsulfonylphenyl)ethanol |
| SMILES | CS(=O)(=O)c1ccc(C(O)CN2CCCC3CCCC32)cc1 |
| InChI | InChI=1S/C17H25NO3S/c1-22(20,21)15-9-7-14(8-10-15)17(19)12-18-11-3-5-13-4-2-6-16(13)18/h7-10,13,16-17,19H,2-6,11-12H2,1H3 |
| InChIKey | NUAVXRUSBNLILQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |