C30H27NO3S — CID 100932574
(1R)-2-(benzenesulfonyl)-1-[(2S)-1-tritylaziridin-2-yl]prop-2-en-1-ol (PubChem CID 100932574) has the molecular formula C30H27NO3S and a molecular weight of 481.62 g/mol. Its IUPAC name is (1R)-2-(benzenesulfonyl)-1-[(2S)-1-tritylaziridin-2-yl]prop-2-en-1-ol.
| Compound Name | (1R)-2-(benzenesulfonyl)-1-[(2S)-1-tritylaziridin-2-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 100932574 |
| Molecular Formula | C30H27NO3S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | (1R)-2-(benzenesulfonyl)-1-[(2S)-1-tritylaziridin-2-yl]prop-2-en-1-ol |
| SMILES | C=C([C@H](O)[C@@H]1CN1C(c1ccccc1)(c1ccccc1)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H27NO3S/c1-23(35(33,34)27-20-12-5-13-21-27)29(32)28-22-31(28)30(24-14-6-2-7-15-24,25-16-8-3-9-17-25)26-18-10-4-11-19-26/h2-21,28-29,32H,1,22H2/t28-,29-,31?/m0/s1 |
| InChIKey | CKZKMVVHJFVOJS-MYABOAQRSA-N |
| XLogP | 5.01 |
| TPSA | 57.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|