C21H18O3S — CID 139779830
2-(benzenesulfonyl)-1,1-diphenylprop-2-en-1-ol (PubChem CID 139779830) has the molecular formula C21H18O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-1,1-diphenylprop-2-en-1-ol.
| Compound Name | 2-(benzenesulfonyl)-1,1-diphenylprop-2-en-1-ol |
|---|---|
| PubChem CID | 139779830 |
| Molecular Formula | C21H18O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 2-(benzenesulfonyl)-1,1-diphenylprop-2-en-1-ol |
| SMILES | C=C(C(O)(c1ccccc1)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H18O3S/c1-17(25(23,24)20-15-9-4-10-16-20)21(22,18-11-5-2-6-12-18)19-13-7-3-8-14-19/h2-16,22H,1H2 |
| InChIKey | UQUMHZYTEDKLBL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |