C21H21NO — CID 102287249
[(2S)-1-(cyclopenta-2,4-dien-1-ylmethyl)aziridin-2-yl]-diphenylmethanol (PubChem CID 102287249) has the molecular formula C21H21NO and a molecular weight of 303.41 g/mol. Its IUPAC name is [(2S)-1-(cyclopenta-2,4-dien-1-ylmethyl)aziridin-2-yl]-diphenylmethanol.
| Compound Name | [(2S)-1-(cyclopenta-2,4-dien-1-ylmethyl)aziridin-2-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 102287249 |
| Molecular Formula | C21H21NO |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | [(2S)-1-(cyclopenta-2,4-dien-1-ylmethyl)aziridin-2-yl]-diphenylmethanol |
| SMILES | OC(c1ccccc1)(c1ccccc1)[C@@H]1CN1CC1C=CC=C1 |
| InChI | InChI=1S/C21H21NO/c23-21(18-11-3-1-4-12-18,19-13-5-2-6-14-19)20-16-22(20)15-17-9-7-8-10-17/h1-14,17,20,23H,15-16H2/t20-,22?/m0/s1 |
| InChIKey | WIKGTGAHDPEZGH-AIBWNMTMSA-N |
| XLogP | 3.35 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|