C20H33N2O+ — CID 24199
1-cyclohexyl-2-(4,4-dimethylpiperazin-4-ium-1-yl)-1-phenylethanol (PubChem CID 24199) has the molecular formula C20H33N2O+ and a molecular weight of 317.50 g/mol. Its IUPAC name is 1-cyclohexyl-2-(4,4-dimethylpiperazin-4-ium-1-yl)-1-phenylethanol.
| Compound Name | 1-cyclohexyl-2-(4,4-dimethylpiperazin-4-ium-1-yl)-1-phenylethanol |
|---|---|
| PubChem CID | 24199 |
| Molecular Formula | C20H33N2O+ |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.26 |
| IUPAC Name | 1-cyclohexyl-2-(4,4-dimethylpiperazin-4-ium-1-yl)-1-phenylethanol |
| SMILES | C[N+]1(C)CCN(CC(O)(c2ccccc2)C2CCCCC2)CC1 |
| InChI | InChI=1S/C20H33N2O/c1-22(2)15-13-21(14-16-22)17-20(23,18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3,5-6,9-10,19,23H,4,7-8,11-17H2,1-2H3/q+1 |
| InChIKey | ZRYHPQCHHOKSMD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|