C17H20F3NO — CID 15350966
(3S,5S,8aS)-3-phenyl-5-prop-2-enyl-8a-(trifluoromethyl)-2,3,5,6,7,8-hexahydro-[1,3]oxazolo[3,2-a]pyridine (PubChem CID 15350966) has the molecular formula C17H20F3NO and a molecular weight of 311.35 g/mol. Its IUPAC name is (3S,5S,8aS)-3-phenyl-5-prop-2-enyl-8a-(trifluoromethyl)-2,3,5,6,7,8-hexahydro-[1,3]oxazolo[3,2-a]pyridine.
| Compound Name | (3S,5S,8aS)-3-phenyl-5-prop-2-enyl-8a-(trifluoromethyl)-2,3,5,6,7,8-hexahydro-[1,3]oxazolo[3,2-a]pyridine |
|---|---|
| PubChem CID | 15350966 |
| Molecular Formula | C17H20F3NO |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | (3S,5S,8aS)-3-phenyl-5-prop-2-enyl-8a-(trifluoromethyl)-2,3,5,6,7,8-hexahydro-[1,3]oxazolo[3,2-a]pyridine |
| SMILES | C=CC[C@@H]1CCC[C@@]2(C(F)(F)F)OC[C@H](c3ccccc3)N12 |
| InChI | InChI=1S/C17H20F3NO/c1-2-7-14-10-6-11-16(17(18,19)20)21(14)15(12-22-16)13-8-4-3-5-9-13/h2-5,8-9,14-15H,1,6-7,10-12H2/t14-,15-,16+/m1/s1 |
| InChIKey | URWTZFWIRUTGAD-OAGGEKHMSA-N |
| XLogP | 4.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|