C23H24BNO2 — CID 102481746
[2-[[(2R,5R)-2,5-diphenylpyrrolidin-1-yl]methyl]phenyl]boronic acid (PubChem CID 102481746) has the molecular formula C23H24BNO2 and a molecular weight of 357.26 g/mol. Its IUPAC name is [2-[[(2R,5R)-2,5-diphenylpyrrolidin-1-yl]methyl]phenyl]boronic acid.
| Compound Name | [2-[[(2R,5R)-2,5-diphenylpyrrolidin-1-yl]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 102481746 |
| Molecular Formula | C23H24BNO2 |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | [2-[[(2R,5R)-2,5-diphenylpyrrolidin-1-yl]methyl]phenyl]boronic acid |
| SMILES | OB(O)c1ccccc1CN1[C@@H](c2ccccc2)CC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C23H24BNO2/c26-24(27)21-14-8-7-13-20(21)17-25-22(18-9-3-1-4-10-18)15-16-23(25)19-11-5-2-6-12-19/h1-14,22-23,26-27H,15-17H2/t22-,23-/m1/s1 |
| InChIKey | XRVJLBUJYBZRRY-DHIUTWEWSA-N |
| XLogP | 3.44 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|