C10H12BrO2P — CID 102301474
(2S,3R)-2-bromo-1-oxo-1-phenyl-1λ5-phospholan-3-ol (PubChem CID 102301474) has the molecular formula C10H12BrO2P and a molecular weight of 275.08 g/mol. Its IUPAC name is (2S,3R)-2-bromo-1-oxo-1-phenyl-1λ5-phospholan-3-ol.
| Compound Name | (2S,3R)-2-bromo-1-oxo-1-phenyl-1λ5-phospholan-3-ol |
|---|---|
| PubChem CID | 102301474 |
| Molecular Formula | C10H12BrO2P |
| Molecular Weight | 275.08 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | (2S,3R)-2-bromo-1-oxo-1-phenyl-1λ5-phospholan-3-ol |
| SMILES | O=P1(c2ccccc2)CC[C@@H](O)[C@@H]1Br |
| InChI | InChI=1S/C10H12BrO2P/c11-10-9(12)6-7-14(10,13)8-4-2-1-3-5-8/h1-5,9-10,12H,6-7H2/t9-,10-,14?/m1/s1 |
| InChIKey | JIHYNLFMFJCOGQ-QYFJWPRKSA-N |
| XLogP | 2.16 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.08 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|