C10H11O2P — CID 11865274
(1R,3R)-1-oxo-1-phenyl-2,3-dihydro-1λ5-phosphol-3-ol (PubChem CID 11865274) has the molecular formula C10H11O2P and a molecular weight of 194.17 g/mol. Its IUPAC name is (1R,3R)-1-oxo-1-phenyl-2,3-dihydro-1λ5-phosphol-3-ol.
| Compound Name | (1R,3R)-1-oxo-1-phenyl-2,3-dihydro-1λ5-phosphol-3-ol |
|---|---|
| PubChem CID | 11865274 |
| Molecular Formula | C10H11O2P |
| Molecular Weight | 194.17 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | (1R,3R)-1-oxo-1-phenyl-2,3-dihydro-1λ5-phosphol-3-ol |
| SMILES | O=[P@@]1(c2ccccc2)C=C[C@@H](O)C1 |
| InChI | InChI=1S/C10H11O2P/c11-9-6-7-13(12,8-9)10-4-2-1-3-5-10/h1-7,9,11H,8H2/t9-,13+/m1/s1 |
| InChIKey | VTAVCWPONNWXJO-RNCFNFMXSA-N |
| XLogP | 1.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.17 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|