C13H19OPSe — CID 12590783
(1R,2R,4R,5S)-2,5-dimethyl-1-phenyl-1-selanylidene-1λ5-phosphinan-4-ol (PubChem CID 12590783) has the molecular formula C13H19OPSe and a molecular weight of 301.23 g/mol. Its IUPAC name is (1R,2R,4R,5S)-2,5-dimethyl-1-phenyl-1-selanylidene-1λ5-phosphinan-4-ol.
| Compound Name | (1R,2R,4R,5S)-2,5-dimethyl-1-phenyl-1-selanylidene-1λ5-phosphinan-4-ol |
|---|---|
| PubChem CID | 12590783 |
| Molecular Formula | C13H19OPSe |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | (1R,2R,4R,5S)-2,5-dimethyl-1-phenyl-1-selanylidene-1λ5-phosphinan-4-ol |
| SMILES | C[C@@H]1C[P@](=[Se])(c2ccccc2)[C@H](C)C[C@H]1O |
| InChI | InChI=1S/C13H19OPSe/c1-10-9-15(16,11(2)8-13(10)14)12-6-4-3-5-7-12/h3-7,10-11,13-14H,8-9H2,1-2H3/t10-,11-,13-,15-/m1/s1 |
| InChIKey | DWVRDKPYIKYMTO-NLRBGTRBSA-N |
| XLogP | 2.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|