C15H21O2PSe — CID 25240773
[(1R,2R,4R,5R)-2,5-dimethyl-1-phenyl-1-selanylidene-1λ5-phosphinan-4-yl] acetate (PubChem CID 25240773) has the molecular formula C15H21O2PSe and a molecular weight of 343.27 g/mol. Its IUPAC name is [(1R,2R,4R,5R)-2,5-dimethyl-1-phenyl-1-selanylidene-1λ5-phosphinan-4-yl] acetate.
| Compound Name | [(1R,2R,4R,5R)-2,5-dimethyl-1-phenyl-1-selanylidene-1λ5-phosphinan-4-yl] acetate |
|---|---|
| PubChem CID | 25240773 |
| Molecular Formula | C15H21O2PSe |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | [(1R,2R,4R,5R)-2,5-dimethyl-1-phenyl-1-selanylidene-1λ5-phosphinan-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H](C)[P@@](=[Se])(c2ccccc2)C[C@@H]1C |
| InChI | InChI=1S/C15H21O2PSe/c1-11-10-18(19,14-7-5-4-6-8-14)12(2)9-15(11)17-13(3)16/h4-8,11-12,15H,9-10H2,1-3H3/t11-,12+,15+,18+/m0/s1 |
| InChIKey | XORKLSQOHMCHTN-NYPXFFEGSA-N |
| XLogP | 2.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|