C13H17O5P — CID 102145354
[4-hydroxy-5-(hydroxymethyl)-1-oxo-1-phenyl-1λ5-phospholan-3-yl] acetate (PubChem CID 102145354) has the molecular formula C13H17O5P and a molecular weight of 284.25 g/mol. Its IUPAC name is [4-hydroxy-5-(hydroxymethyl)-1-oxo-1-phenyl-1λ5-phospholan-3-yl] acetate.
| Compound Name | [4-hydroxy-5-(hydroxymethyl)-1-oxo-1-phenyl-1λ5-phospholan-3-yl] acetate |
|---|---|
| PubChem CID | 102145354 |
| Molecular Formula | C13H17O5P |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | [4-hydroxy-5-(hydroxymethyl)-1-oxo-1-phenyl-1λ5-phospholan-3-yl] acetate |
| SMILES | CC(=O)OC1CP(=O)(c2ccccc2)C(CO)C1O |
| InChI | InChI=1S/C13H17O5P/c1-9(15)18-11-8-19(17,12(7-14)13(11)16)10-5-3-2-4-6-10/h2-6,11-14,16H,7-8H2,1H3 |
| InChIKey | JGLJMDYJAYZBQK-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|