C15H21O2PS — CID 23266607
[(1R,2R,4S,5R)-2,5-dimethyl-1-phenyl-1-sulfanylidene-1λ5-phosphinan-4-yl] acetate (PubChem CID 23266607) has the molecular formula C15H21O2PS and a molecular weight of 296.37 g/mol. Its IUPAC name is [(1R,2R,4S,5R)-2,5-dimethyl-1-phenyl-1-sulfanylidene-1λ5-phosphinan-4-yl] acetate.
| Compound Name | [(1R,2R,4S,5R)-2,5-dimethyl-1-phenyl-1-sulfanylidene-1λ5-phosphinan-4-yl] acetate |
|---|---|
| PubChem CID | 23266607 |
| Molecular Formula | C15H21O2PS |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | [(1R,2R,4S,5R)-2,5-dimethyl-1-phenyl-1-sulfanylidene-1λ5-phosphinan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H](C)[P@@](=S)(c2ccccc2)C[C@@H]1C |
| InChI | InChI=1S/C15H21O2PS/c1-11-10-18(19,14-7-5-4-6-8-14)12(2)9-15(11)17-13(3)16/h4-8,11-12,15H,9-10H2,1-3H3/t11-,12+,15-,18+/m0/s1 |
| InChIKey | PHIWIOZDEOZOIN-ZQUVKOLYSA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|