About 3-[2-(1-oxo-1-phenyl-1λ5-phospholan-3-yl)ethyl]-1-phenyl-1λ5-phospholane 1-oxide
3-[2-(1-oxo-1-phenyl-1λ5-phospholan-3-yl)ethyl]-1-phenyl-1λ5-phospholane 1-oxide (PubChem CID 132561705) has the molecular formula C22H28O2P2
and a molecular weight of 386.41 g/mol. Its IUPAC name is 3-[2-(1-oxo-1-phenyl-1λ5-phospholan-3-yl)ethyl]-1-phenyl-1λ5-phospholane 1-oxide.
Molecular Properties
| Compound Name | 3-[2-(1-oxo-1-phenyl-1λ5-phospholan-3-yl)ethyl]-1-phenyl-1λ5-phospholane 1-oxide |
| PubChem CID | 132561705 |
| Molecular Formula | C22H28O2P2 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 3-[2-(1-oxo-1-phenyl-1λ5-phospholan-3-yl)ethyl]-1-phenyl-1λ5-phospholane 1-oxide |
| SMILES | O=P1(c2ccccc2)CCC(CCC2CCP(=O)(c3ccccc3)C2)C1 |
| InChI | InChI=1S/C22H28O2P2/c23-25(21-7-3-1-4-8-21)15-13-19(17-25)11-12-20-14-16-26(24,18-20)22-9-5-2-6-10-22/h1-10,19-20H,11-18H2 |
| InChIKey | WZHZMNQNDHIDQM-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(1-oxo-1-phenyl-1λ5-phospholan-3-yl)ethyl]-1-phenyl-1λ5-phospholane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(1-oxo-1-phenyl-1λ5-phospholan-3-yl)ethyl]-1-phenyl-1λ5-phospholane 1-oxide?
The IUPAC name of 3-[2-(1-oxo-1-phenyl-1λ5-phospholan-3-yl)ethyl]-1-phenyl-1λ5-phospholane 1-oxide (CID 132561705) is 3-[2-(1-oxo-1-phenyl-1λ5-phospholan-3-yl)ethyl]-1-phenyl-1λ5-phospholane 1-oxide.
What is the SMILES notation for 3-[2-(1-oxo-1-phenyl-1λ5-phospholan-3-yl)ethyl]-1-phenyl-1λ5-phospholane 1-oxide?
The canonical SMILES for 3-[2-(1-oxo-1-phenyl-1λ5-phospholan-3-yl)ethyl]-1-phenyl-1λ5-phospholane 1-oxide is O=P1(c2ccccc2)CCC(CCC2CCP(=O)(c3ccccc3)C2)C1.
What is the InChIKey of 3-[2-(1-oxo-1-phenyl-1λ5-phospholan-3-yl)ethyl]-1-phenyl-1λ5-phospholane 1-oxide?
The InChIKey is WZHZMNQNDHIDQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28O2P2/c23-25(21-7-3-1-4-8-21)15-13-19(17-25)11-12-20-14-16-26(24,18-20)22-9-5-2-6-10-22/h1-10,19-20H,11-18H2.
What are the key properties of 3-[2-(1-oxo-1-phenyl-1λ5-phospholan-3-yl)ethyl]-1-phenyl-1λ5-phospholane 1-oxide?
3-[2-(1-oxo-1-phenyl-1λ5-phospholan-3-yl)ethyl]-1-phenyl-1λ5-phospholane 1-oxide has a molecular weight of 386.41 g/mol, XLogP of 5.18, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(1-oxo-1-phenyl-1λ5-phospholan-3-yl)ethyl]-1-phenyl-1λ5-phospholane 1-oxide is sourced from PubChem (CID 132561705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).