C11H14BrO2P — CID 134986821
(1R,2R,3S)-2-bromo-3-methoxy-1-phenyl-1λ5-phospholane 1-oxide (PubChem CID 134986821) has the molecular formula C11H14BrO2P and a molecular weight of 289.11 g/mol. Its IUPAC name is (1R,2R,3S)-2-bromo-3-methoxy-1-phenyl-1λ5-phospholane 1-oxide.
| Compound Name | (1R,2R,3S)-2-bromo-3-methoxy-1-phenyl-1λ5-phospholane 1-oxide |
|---|---|
| PubChem CID | 134986821 |
| Molecular Formula | C11H14BrO2P |
| Molecular Weight | 289.11 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | (1R,2R,3S)-2-bromo-3-methoxy-1-phenyl-1λ5-phospholane 1-oxide |
| SMILES | CO[C@H]1CC[P@@](=O)(c2ccccc2)[C@@H]1Br |
| InChI | InChI=1S/C11H14BrO2P/c1-14-10-7-8-15(13,11(10)12)9-5-3-2-4-6-9/h2-6,10-11H,7-8H2,1H3/t10-,11-,15+/m0/s1 |
| InChIKey | WUNXOKLFUMDZCW-ZIBATOQPSA-N |
| XLogP | 2.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.11 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|