C25H28O2P2 — CID 91380508
(1R,2R)-2-(2-diphenylphosphorylpropan-2-yl)-1-phenyl-1λ5-phospholane 1-oxide (PubChem CID 91380508) has the molecular formula C25H28O2P2 and a molecular weight of 422.44 g/mol. Its IUPAC name is (1R,2R)-2-(2-diphenylphosphorylpropan-2-yl)-1-phenyl-1λ5-phospholane 1-oxide.
| Compound Name | (1R,2R)-2-(2-diphenylphosphorylpropan-2-yl)-1-phenyl-1λ5-phospholane 1-oxide |
|---|---|
| PubChem CID | 91380508 |
| Molecular Formula | C25H28O2P2 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | (1R,2R)-2-(2-diphenylphosphorylpropan-2-yl)-1-phenyl-1λ5-phospholane 1-oxide |
| SMILES | CC(C)([C@H]1CCC[P@]1(=O)c1ccccc1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H28O2P2/c1-25(2,24-19-12-20-28(24,26)21-13-6-3-7-14-21)29(27,22-15-8-4-9-16-22)23-17-10-5-11-18-23/h3-11,13-18,24H,12,19-20H2,1-2H3/t24-,28+/m1/s1 |
| InChIKey | OWACHFMUPDVBAC-YWEHKCAJSA-N |
| XLogP | 5.63 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|