C14H19O3P — CID 68526810
ethyl 2-(1-oxo-1-phenyl-1λ5-phospholan-2-yl)acetate (PubChem CID 68526810) has the molecular formula C14H19O3P and a molecular weight of 266.28 g/mol. Its IUPAC name is ethyl 2-(1-oxo-1-phenyl-1λ5-phospholan-2-yl)acetate.
| Compound Name | ethyl 2-(1-oxo-1-phenyl-1λ5-phospholan-2-yl)acetate |
|---|---|
| PubChem CID | 68526810 |
| Molecular Formula | C14H19O3P |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | ethyl 2-(1-oxo-1-phenyl-1λ5-phospholan-2-yl)acetate |
| SMILES | CCOC(=O)CC1CCCP1(=O)c1ccccc1 |
| InChI | InChI=1S/C14H19O3P/c1-2-17-14(15)11-13-9-6-10-18(13,16)12-7-4-3-5-8-12/h3-5,7-8,13H,2,6,9-11H2,1H3 |
| InChIKey | VSYZXPJVIIUZIQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|