C14H17O3P — CID 68524102
ethyl 2-[(1R,2S)-1-oxo-1-phenyl-2,5-dihydro-1λ5-phosphol-2-yl]acetate (PubChem CID 68524102) has the molecular formula C14H17O3P and a molecular weight of 264.26 g/mol. Its IUPAC name is ethyl 2-[(1R,2S)-1-oxo-1-phenyl-2,5-dihydro-1λ5-phosphol-2-yl]acetate.
| Compound Name | ethyl 2-[(1R,2S)-1-oxo-1-phenyl-2,5-dihydro-1λ5-phosphol-2-yl]acetate |
|---|---|
| PubChem CID | 68524102 |
| Molecular Formula | C14H17O3P |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | ethyl 2-[(1R,2S)-1-oxo-1-phenyl-2,5-dihydro-1λ5-phosphol-2-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1C=CC[P@]1(=O)c1ccccc1 |
| InChI | InChI=1S/C14H17O3P/c1-2-17-14(15)11-13-9-6-10-18(13,16)12-7-4-3-5-8-12/h3-9,13H,2,10-11H2,1H3/t13-,18+/m1/s1 |
| InChIKey | YFIKYZUMDFCSEW-ACJLOTCBSA-N |
| XLogP | 2.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|