C14H15NO3 — CID 163768240
ethyl 2-[(1S,4S)-4-nitroso-1,4-dihydronaphthalen-1-yl]acetate (PubChem CID 163768240) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is ethyl 2-[(1S,4S)-4-nitroso-1,4-dihydronaphthalen-1-yl]acetate.
| Compound Name | ethyl 2-[(1S,4S)-4-nitroso-1,4-dihydronaphthalen-1-yl]acetate |
|---|---|
| PubChem CID | 163768240 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | ethyl 2-[(1S,4S)-4-nitroso-1,4-dihydronaphthalen-1-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1C=C[C@H](N=O)c2ccccc21 |
| InChI | InChI=1S/C14H15NO3/c1-2-18-14(16)9-10-7-8-13(15-17)12-6-4-3-5-11(10)12/h3-8,10,13H,2,9H2,1H3/t10-,13+/m1/s1 |
| InChIKey | MEFBPIFFUBQUPA-MFKMUULPSA-N |
| XLogP | 3.10 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|