C12H16N2O3 — CID 175038908
ethyl 2-(2-hydroxy-1-methyl-3H-indazol-3-yl)acetate (PubChem CID 175038908) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is ethyl 2-(2-hydroxy-1-methyl-3H-indazol-3-yl)acetate.
| Compound Name | ethyl 2-(2-hydroxy-1-methyl-3H-indazol-3-yl)acetate |
|---|---|
| PubChem CID | 175038908 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | ethyl 2-(2-hydroxy-1-methyl-3H-indazol-3-yl)acetate |
| SMILES | CCOC(=O)CC1c2ccccc2N(C)N1O |
| InChI | InChI=1S/C12H16N2O3/c1-3-17-12(15)8-11-9-6-4-5-7-10(9)13(2)14(11)16/h4-7,11,16H,3,8H2,1-2H3 |
| InChIKey | AJRILNIKHDFHEE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |