C15H19BO3S — CID 59083054
ethyl 2-[(1S,4S)-4-[[deuterio(tritio)boranyl]methylsulfanyloxy]-1,4-dihydronaphthalen-1-yl]acetate (PubChem CID 59083054) has the molecular formula C15H19BO3S and a molecular weight of 293.21 g/mol. Its IUPAC name is ethyl 2-[(1S,4S)-4-[[deuterio(tritio)boranyl]methylsulfanyloxy]-1,4-dihydronaphthalen-1-yl]acetate.
| Compound Name | ethyl 2-[(1S,4S)-4-[[deuterio(tritio)boranyl]methylsulfanyloxy]-1,4-dihydronaphthalen-1-yl]acetate |
|---|---|
| PubChem CID | 59083054 |
| Molecular Formula | C15H19BO3S |
| Molecular Weight | 293.21 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | ethyl 2-[(1S,4S)-4-[[deuterio(tritio)boranyl]methylsulfanyloxy]-1,4-dihydronaphthalen-1-yl]acetate |
| SMILES | [2H]B([3H])CSO[C@H]1C=C[C@H](CC(=O)OCC)c2ccccc21 |
| InChI | InChI=1S/C15H19BO3S/c1-2-18-15(17)9-11-7-8-14(19-20-10-16)13-6-4-3-5-12(11)13/h3-8,11,14H,2,9-10,16H2,1H3/t11-,14+/m1/s1/i16TD |
| InChIKey | UOBFHVZPZOCJMI-SUYFFUEHSA-N |
| XLogP | 2.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|