C11H15NO3 — CID 152509267
ethyl 2-(6-methoxyiminocyclohexa-2,4-dien-1-yl)acetate (PubChem CID 152509267) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is ethyl 2-(6-methoxyiminocyclohexa-2,4-dien-1-yl)acetate.
| Compound Name | ethyl 2-(6-methoxyiminocyclohexa-2,4-dien-1-yl)acetate |
|---|---|
| PubChem CID | 152509267 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | ethyl 2-(6-methoxyiminocyclohexa-2,4-dien-1-yl)acetate |
| SMILES | CCOC(=O)CC1C=CC=CC1=NOC |
| InChI | InChI=1S/C11H15NO3/c1-3-15-11(13)8-9-6-4-5-7-10(9)12-14-2/h4-7,9H,3,8H2,1-2H3 |
| InChIKey | YFDHVPQFLIXLLD-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|